CAS 142167-38-2 appears in our catalog under these names: 5–Bromo–4–chloro–2–hydroxybenzoic acid, 5-Bromo-4-chloro-2-hydroxybenzoic acid, 98%, 5-Bromo-4-chloro-2-hydroxybenzoic acid 98%, 5-Bromo-4-chloro-2-hydroxybenzoic acid, 98%, 98%. Offered by: GLPBio, Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 25g, 10g, 5g, 250mg.
5-bromo-4-chloro-2-hydroxybenzoic acid (CAS 142167-38-2) is a chemical compound with the molecular formula C7H4BrClO3 and a molecular weight of 251.46 g/mol. IUPAC name: 5-bromo-4-chloro-2-hydroxybenzoic acid. InChIKey: XUKLAPBPFXGIOW-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClO3 |
|---|---|
| Molecular weight | 251.46 g/mol |
| IUPAC name | 5-bromo-4-chloro-2-hydroxybenzoic acid |
| InChIKey | XUKLAPBPFXGIOW-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Br)Cl)O)C(=O)O |
Computed by PubChem (NCBI)