cas: 929621-33-0 — see every product listed under this CAS number, including other names
4-Bromo-2-chloro-6-fluorobenzaldehyde, 95%, 95% (CAS 929621-33-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IHEX-100mg |
| cas | 929621-33-0 |
| size | 100mg |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 174.80 Pln | |
| Chemat | 1g | 371.60 Pln | |
| Chemat | 5g | 966.80 Pln | |
| Chemat | 10g | 1523.60 Pln | |
| Chemat | 25g | 2891.60 Pln | |
| Chemat | 250g | 8498.00 Pln | |
| Chemat | 500g | 17016.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-bromo-2-chloro-6-fluorobenzaldehyde (CAS 929621-33-0) is a chemical compound with the molecular formula C7H3BrClFO and a molecular weight of 237.45 g/mol. IUPAC name: 4-bromo-2-chloro-6-fluorobenzaldehyde. InChIKey: SEDZRCPUNFGODD-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClFO |
|---|---|
| Molecular weight | 237.45 g/mol |
| IUPAC name | 4-bromo-2-chloro-6-fluorobenzaldehyde |
| InChIKey | SEDZRCPUNFGODD-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)C=O)Cl)Br |
Computed by PubChem (NCBI)