cas: 929621-33-0 — see every product listed under this CAS number, including other names
4-Bromo-2-chloro-6-fluorobenzaldehyde, 98% (CAS 929621-33-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F472800-250MG |
| cas | 929621-33-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 216.61 Pln | |
| Fluorochem | 1g | 424.87 Pln | |
| Fluorochem | 5g | 1158.98 Pln | |
| Fluorochem | 10g | 1841.04 Pln | |
| Fluorochem | 25g | 3465.46 Pln | |
| Fluorochem | 100mg | 190.58 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-bromo-2-chloro-6-fluorobenzaldehyde (CAS 929621-33-0) is a chemical compound with the molecular formula C7H3BrClFO and a molecular weight of 237.45 g/mol. IUPAC name: 4-bromo-2-chloro-6-fluorobenzaldehyde. InChIKey: SEDZRCPUNFGODD-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClFO |
|---|---|
| Molecular weight | 237.45 g/mol |
| IUPAC name | 4-bromo-2-chloro-6-fluorobenzaldehyde |
| InChIKey | SEDZRCPUNFGODD-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)C=O)Cl)Br |
Computed by PubChem (NCBI)