4-Bromo-2-fluoro-3-methoxybenzoic acid 98%
cas: 194804-92-7 — see every product listed under this CAS number, including other names
4-Bromo-2-fluoro-3-methoxybenzoic acid 98% (CAS 194804-92-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A241624-100mg |
| cas | 194804-92-7 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 142.31 Pln | |
| Ambeed | 250mg | 192.38 Pln | |
| Ambeed | 1g | 487.19 Pln | |
| Ambeed | 5g | 1327.12 Pln | |
| Ambeed | 10g | 2267.19 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A241624 |
4-bromo-2-fluoro-3-methoxybenzoic acid (CAS 194804-92-7) is a chemical compound with the molecular formula C8H6BrFO3 and a molecular weight of 249.03 g/mol. IUPAC name: 4-bromo-2-fluoro-3-methoxybenzoic acid. InChIKey: FJOKKTOXWITJGO-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO3 |
|---|---|
| Molecular weight | 249.03 g/mol |
| IUPAC name | 4-bromo-2-fluoro-3-methoxybenzoic acid |
| InChIKey | FJOKKTOXWITJGO-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1F)C(=O)O)Br |
Computed by PubChem (NCBI)