cas: 5455-13-0 — see every product listed under this CAS number, including other names
4-Bromo-2-phenylaniline, 95%, 95% (CAS 5455-13-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DKZU-100mg |
| cas | 5455-13-0 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 578.00 Pln | |
| Chemat | 250mg | 750.80 Pln | |
| Chemat | 1g | 1442.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-bromo-2-phenylaniline (CAS 5455-13-0) is a chemical compound with the molecular formula C12H10BrN and a molecular weight of 248.12 g/mol. IUPAC name: 4-bromo-2-phenylaniline. InChIKey: QNZCSSKDCUYENG-UHFFFAOYSA-N.
| Molecular formula | C12H10BrN |
|---|---|
| Molecular weight | 248.12 g/mol |
| IUPAC name | 4-bromo-2-phenylaniline |
| InChIKey | QNZCSSKDCUYENG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=CC(=C2)Br)N |
Computed by PubChem (NCBI)