cas: 1221716-04-6 — see every product listed under this CAS number, including other names
4-Bromo-3-(trifluoromethoxy)benzaldehyde (CAS 1221716-04-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F334737-5G |
| cas | 1221716-04-6 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 6219.70 Pln | |
| Fluorochem | 1g | 2122.19 Pln |
| delivery time | 3-4 weeks |
|---|
4-bromo-3-(trifluoromethoxy)benzaldehyde (CAS 1221716-04-6) is a chemical compound with the molecular formula C8H4BrF3O2 and a molecular weight of 269.01 g/mol. IUPAC name: 4-bromo-3-(trifluoromethoxy)benzaldehyde. InChIKey: OXGOZHICCQUYTM-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF3O2 |
|---|---|
| Molecular weight | 269.01 g/mol |
| IUPAC name | 4-bromo-3-(trifluoromethoxy)benzaldehyde |
| InChIKey | OXGOZHICCQUYTM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C=O)OC(F)(F)F)Br |
Computed by PubChem (NCBI)