cas: 1696224-75-5 — see every product listed under this CAS number, including other names
4-Bromo-3-chloro-2-fluorobenzaldehyde, 95%, 95% (CAS 1696224-75-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12EM9Z-100mg |
| cas | 1696224-75-5 |
| size | 100mg |
| availability | 7g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 237.20 Pln | |
| Chemat | 250mg | 410.00 Pln | |
| Chemat | 1g | 938.00 Pln | |
| Chemat | 5g | 2690.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-bromo-3-chloro-2-fluorobenzaldehyde (CAS 1696224-75-5) is a chemical compound with the molecular formula C7H3BrClFO and a molecular weight of 237.45 g/mol. IUPAC name: 4-bromo-3-chloro-2-fluorobenzaldehyde. InChIKey: WHSKLGAULKIGTA-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClFO |
|---|---|
| Molecular weight | 237.45 g/mol |
| IUPAC name | 4-bromo-3-chloro-2-fluorobenzaldehyde |
| InChIKey | WHSKLGAULKIGTA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C=O)F)Cl)Br |
Computed by PubChem (NCBI)