cas: 1696224-75-5 — see every product listed under this CAS number, including other names
4-Bromo-3-chloro-2-fluorobenzaldehyde, 97% (CAS 1696224-75-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 250mg, 500mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A316575-10g |
| cas | 1696224-75-5 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 14287.84 Pln | |
| AmBeed | 25g | 27913.27 Pln | |
| Fluorochem | 250mg | 690.40 Pln | |
| Fluorochem | 500mg | 1002.79 Pln | |
| Fluorochem | 1g | 1611.95 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-bromo-3-chloro-2-fluorobenzaldehyde (CAS 1696224-75-5) is a chemical compound with the molecular formula C7H3BrClFO and a molecular weight of 237.45 g/mol. IUPAC name: 4-bromo-3-chloro-2-fluorobenzaldehyde. InChIKey: WHSKLGAULKIGTA-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClFO |
|---|---|
| Molecular weight | 237.45 g/mol |
| IUPAC name | 4-bromo-3-chloro-2-fluorobenzaldehyde |
| InChIKey | WHSKLGAULKIGTA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C=O)F)Cl)Br |
Computed by PubChem (NCBI)