CAS 1349716-97-7 appears in our catalog under these names: 4-Bromo-3-fluoro-2-methylbenzoic acid, 97%, 97%, 4-Bromo-3-fluoro-2-methylbenzoic acid, 95%, 4-Bromo-3-fluoro-2-methylbenzoic acid, 4-Bromo-3-fluoro-2-methylbenzoic acid, 97%. Offered by: Chemat, Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 500mg.
4-bromo-3-fluoro-2-methylbenzoic acid (CAS 1349716-97-7) is a chemical compound with the molecular formula C8H6BrFO2 and a molecular weight of 233.03 g/mol. IUPAC name: 4-bromo-3-fluoro-2-methylbenzoic acid. InChIKey: BVAPYHANHITQQW-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO2 |
|---|---|
| Molecular weight | 233.03 g/mol |
| IUPAC name | 4-bromo-3-fluoro-2-methylbenzoic acid |
| InChIKey | BVAPYHANHITQQW-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1F)Br)C(=O)O |
Computed by PubChem (NCBI)