cas: 56256-14-5 — see every product listed under this CAS number, including other names
4-Bromo-3-methoxybenzoic acid 95% (CAS 56256-14-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A346873-1g |
| cas | 56256-14-5 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 197.94 Pln | |
| Ambeed | 10g | 220.19 Pln | |
| Ambeed | 25g | 325.88 Pln | |
| Ambeed | 100g | 1093.50 Pln | |
| Ambeed | 500g | 4380.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A346873 |
4-bromo-3-methoxybenzoic acid (CAS 56256-14-5) is a chemical compound with the molecular formula C8H7BrO3 and a molecular weight of 231.04 g/mol. IUPAC name: 4-bromo-3-methoxybenzoic acid. InChIKey: UEVXVBKBOFGKIN-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO3 |
|---|---|
| Molecular weight | 231.04 g/mol |
| IUPAC name | 4-bromo-3-methoxybenzoic acid |
| InChIKey | UEVXVBKBOFGKIN-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C(=O)O)Br |
Computed by PubChem (NCBI)