CAS 56256-14-5 appears in our catalog under these names: 4-Bromo-3-methoxybenzoic acid 95%, 4-Bromo-3-methoxybenzoic acid, 95%. Offered by: Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 50g.
4-bromo-3-methoxybenzoic acid (CAS 56256-14-5) is a chemical compound with the molecular formula C8H7BrO3 and a molecular weight of 231.04 g/mol. IUPAC name: 4-bromo-3-methoxybenzoic acid. InChIKey: UEVXVBKBOFGKIN-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO3 |
|---|---|
| Molecular weight | 231.04 g/mol |
| IUPAC name | 4-bromo-3-methoxybenzoic acid |
| InChIKey | UEVXVBKBOFGKIN-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C(=O)O)Br |
Computed by PubChem (NCBI)