cas: 879-93-6 — see every product listed under this CAS number, including other names
4-Bromo-3-nitrobenzamide, 98%, 98% (CAS 879-93-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119EAN-100mg |
| cas | 879-93-6 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 266.00 Pln | |
| Chemat | 250mg | 400.40 Pln | |
| Chemat | 1g | 746.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-bromo-3-nitrobenzamide (CAS 879-93-6) is a chemical compound with the molecular formula C7H5BrN2O3 and a molecular weight of 245.03 g/mol. IUPAC name: 4-bromo-3-nitrobenzamide. InChIKey: XEXLVJPVLGTROT-UHFFFAOYSA-N.
| Molecular formula | C7H5BrN2O3 |
|---|---|
| Molecular weight | 245.03 g/mol |
| IUPAC name | 4-bromo-3-nitrobenzamide |
| InChIKey | XEXLVJPVLGTROT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)N)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)