cas: 6319-40-0 — see every product listed under this CAS number, including other names
4-Bromo-3-nitrobenzoic acid, 97% (CAS 6319-40-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100g, 25g, 500g, 5g, 10g. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | CA-4449-1g |
| cas | 6319-40-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 100g | price on request | |
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 500g | price on request | |
| Combi-blocks | 5g | price on request | |
| Fluorochem | 1g | 91.65 Pln | |
| Fluorochem | 5g | 107.27 Pln | |
| Fluorochem | 10g | 143.72 Pln | |
| Fluorochem | 25g | 216.61 Pln | |
| Fluorochem | 100g | 685.19 Pln | |
| Fluorochem | 500g | 2663.66 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
4-bromo-3-nitrobenzoic acid (CAS 6319-40-0) is a chemical compound with the molecular formula C7H4BrNO4 and a molecular weight of 246.01 g/mol. IUPAC name: 4-bromo-3-nitrobenzoic acid. InChIKey: RVCTZJVBWNFYRU-UHFFFAOYSA-N.
| Molecular formula | C7H4BrNO4 |
|---|---|
| Molecular weight | 246.01 g/mol |
| IUPAC name | 4-bromo-3-nitrobenzoic acid |
| InChIKey | RVCTZJVBWNFYRU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)