4-Bromo-4'-nitro-1,1'-biphenyl, 95%
cas: 6242-98-4 — see every product listed under this CAS number, including other names
4-Bromo-4'-nitro-1,1'-biphenyl, 95% (CAS 6242-98-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A221655-100mg |
| cas | 6242-98-4 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 192.38 Pln | |
| Ambeed | 250mg | 236.88 Pln | |
| Ambeed | 1g | 342.56 Pln | |
| Ambeed | 5g | 1354.94 Pln | |
| BLDpharm | 100mg | 186.63 Pln | |
| BLDpharm | 250mg | 242.16 Pln | |
| BLDpharm | 1g | 364.34 Pln | |
| BLDpharm | 5g | 1458.40 Pln | |
| Fluorochem | 1g | 341.56 Pln | |
| Fluorochem | 5g | 1362.04 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
1-(4-bromophenyl)-4-nitrobenzene (CAS 6242-98-4) is a chemical compound with the molecular formula C12H8BrNO2 and a molecular weight of 278.10 g/mol. IUPAC name: 1-(4-bromophenyl)-4-nitrobenzene. InChIKey: LNYRWXNUGZFNIE-UHFFFAOYSA-N.
| Molecular formula | C12H8BrNO2 |
|---|---|
| Molecular weight | 278.10 g/mol |
| IUPAC name | 1-(4-bromophenyl)-4-nitrobenzene |
| InChIKey | LNYRWXNUGZFNIE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)
