CAS 928658-23-5 appears in our catalog under these names: 4-(6-Bromo-pyridin-2-yl)-benzoic acid, 95%, 4–(6–Bromopyridin–2–yl)benzoic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg, 100mg.
4-(6-bromo-2-pyridinyl)benzoic acid (CAS 928658-23-5) is a chemical compound with the molecular formula C12H8BrNO2 and a molecular weight of 278.10 g/mol. IUPAC name: 4-(6-bromo-2-pyridinyl)benzoic acid. InChIKey: LJVFAKRRQNUNES-UHFFFAOYSA-N.
| Molecular formula | C12H8BrNO2 |
|---|---|
| Molecular weight | 278.10 g/mol |
| IUPAC name | 4-(6-bromo-2-pyridinyl)benzoic acid |
| InChIKey | LJVFAKRRQNUNES-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)Br)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)