CAS 136649-26-8 appears in our catalog under these names: 3-Bromo-5-nitro-1,1'-biphenyl, 95%, 3-Bromo-5-nitro-1,1'-biphenyl, 95%, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
1-bromo-3-nitro-5-phenylbenzene (CAS 136649-26-8) is a chemical compound with the molecular formula C12H8BrNO2 and a molecular weight of 278.10 g/mol. IUPAC name: 1-bromo-3-nitro-5-phenylbenzene. InChIKey: XMOHNTYISKAKNJ-UHFFFAOYSA-N.
| Molecular formula | C12H8BrNO2 |
|---|---|
| Molecular weight | 278.10 g/mol |
| IUPAC name | 1-bromo-3-nitro-5-phenylbenzene |
| InChIKey | XMOHNTYISKAKNJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC(=C2)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)