CAS 4889-63-8 is the registry number for 5-Bromo-1,2-dihydro-6-nitroacenaphthylene, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g.
5-bromo-6-nitro-1,2-dihydroacenaphthylene (CAS 4889-63-8) is a chemical compound with the molecular formula C12H8BrNO2 and a molecular weight of 278.10 g/mol. IUPAC name: 5-bromo-6-nitro-1,2-dihydroacenaphthylene. InChIKey: RGJQVHVUFZWQGQ-UHFFFAOYSA-N.
| Molecular formula | C12H8BrNO2 |
|---|---|
| Molecular weight | 278.10 g/mol |
| IUPAC name | 5-bromo-6-nitro-1,2-dihydroacenaphthylene |
| InChIKey | RGJQVHVUFZWQGQ-UHFFFAOYSA-N |
| SMILES | C1CC2=CC=C(C3=C(C=CC1=C23)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)