CAS 27701-66-2 is the registry number for 4-Bromo-3-nitro-1,1′-biphenyl, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-bromo-2-nitro-4-phenylbenzene (CAS 27701-66-2) is a chemical compound with the molecular formula C12H8BrNO2 and a molecular weight of 278.10 g/mol. IUPAC name: 1-bromo-2-nitro-4-phenylbenzene. InChIKey: NVBGNJFLYDTGTN-UHFFFAOYSA-N.
| Molecular formula | C12H8BrNO2 |
|---|---|
| Molecular weight | 278.10 g/mol |
| IUPAC name | 1-bromo-2-nitro-4-phenylbenzene |
| InChIKey | NVBGNJFLYDTGTN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(C=C2)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)