CAS 1814881-40-7 is the registry number for 7-Bromo-3,4-dihydro-1H-pyrano[3,4-b]quinolin-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromo-3,4-dihydropyrano[3,4-b]quinolin-1-one (CAS 1814881-40-7) is a chemical compound with the molecular formula C12H8BrNO2 and a molecular weight of 278.10 g/mol. IUPAC name: 7-bromo-3,4-dihydropyrano[3,4-b]quinolin-1-one. InChIKey: XZHAUQKRZFCINS-UHFFFAOYSA-N.
| Molecular formula | C12H8BrNO2 |
|---|---|
| Molecular weight | 278.10 g/mol |
| IUPAC name | 7-bromo-3,4-dihydropyrano[3,4-b]quinolin-1-one |
| InChIKey | XZHAUQKRZFCINS-UHFFFAOYSA-N |
| SMILES | C1COC(=O)C2=C1C=C3C=C(C=CC3=N2)Br |
Computed by PubChem (NCBI)