4-Bromo-5-fluoro-2-methylbenzoic acid, 98%, 98%
cas: 1349715-55-4 — see every product listed under this CAS number, including other names
4-Bromo-5-fluoro-2-methylbenzoic acid, 98%, 98% (CAS 1349715-55-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114AA3-100mg |
| cas | 1349715-55-4 |
| size | 100mg |
| availability | 1000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 102.80 Pln | |
| Chemat | 5g | 232.40 Pln | |
| Chemat | 10g | 400.40 Pln | |
| Chemat | 25g | 890.00 Pln | |
| Chemat | 100g | 2819.60 Pln | |
| Chemat | 250g | 4115.60 Pln | |
| Chemat | 500g | 6177.60 Pln | |
| Chemat | 1kg | 10878.80 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-bromo-5-fluoro-2-methylbenzoic acid (CAS 1349715-55-4) is a chemical compound with the molecular formula C8H6BrFO2 and a molecular weight of 233.03 g/mol. IUPAC name: 4-bromo-5-fluoro-2-methylbenzoic acid. InChIKey: ZIXRUMIXLQUGGN-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO2 |
|---|---|
| Molecular weight | 233.03 g/mol |
| IUPAC name | 4-bromo-5-fluoro-2-methylbenzoic acid |
| InChIKey | ZIXRUMIXLQUGGN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C(=O)O)F)Br |
Computed by PubChem (NCBI)