CAS 1349715-55-4 appears in our catalog under these names: 4–Bromo–5–fluoro–2–methylbenzoic acid, 4-Bromo-5-fluoro-2-methylbenzoic acid, 98%, 4-Bromo-5-fluoro-2-methylbenzoic acid, 98%, 98%. Offered by: GLPBio, Fluorochem, Chemat. Available pack sizes: 1g, 5g, 250mg, 10g, 25g, 100g, 100mg, 250g.
4-bromo-5-fluoro-2-methylbenzoic acid (CAS 1349715-55-4) is a chemical compound with the molecular formula C8H6BrFO2 and a molecular weight of 233.03 g/mol. IUPAC name: 4-bromo-5-fluoro-2-methylbenzoic acid. InChIKey: ZIXRUMIXLQUGGN-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO2 |
|---|---|
| Molecular weight | 233.03 g/mol |
| IUPAC name | 4-bromo-5-fluoro-2-methylbenzoic acid |
| InChIKey | ZIXRUMIXLQUGGN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C(=O)O)F)Br |
Computed by PubChem (NCBI)