CAS 77159-77-4 is the registry number for 4-Bromo-2-chloro-6-methylphenyl isocyanate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
5-bromo-1-chloro-2-isocyanato-3-methylbenzene (CAS 77159-77-4) is a chemical compound with the molecular formula C8H5BrClNO and a molecular weight of 246.49 g/mol. IUPAC name: 5-bromo-1-chloro-2-isocyanato-3-methylbenzene. InChIKey: MBFMISAQCUPLSD-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClNO |
|---|---|
| Molecular weight | 246.49 g/mol |
| IUPAC name | 5-bromo-1-chloro-2-isocyanato-3-methylbenzene |
| InChIKey | MBFMISAQCUPLSD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1N=C=O)Cl)Br |
Computed by PubChem (NCBI)