CAS 1427329-11-0 appears in our catalog under these names: 4-Bromo-2-chloro-6-methoxybenzonitrile, 98%, 4-Bromo-2-chloro-6-methoxybenzonitrile 98%. Offered by: Chemat Brand, Ambeed. Available pack sizes: on request, 250mg, 1g, 5g, 25g.
4-bromo-2-chloro-6-methoxybenzonitrile (CAS 1427329-11-0) is a chemical compound with the molecular formula C8H5BrClNO and a molecular weight of 246.49 g/mol. IUPAC name: 4-bromo-2-chloro-6-methoxybenzonitrile. InChIKey: CUZXFNWNRKLLKW-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClNO |
|---|---|
| Molecular weight | 246.49 g/mol |
| IUPAC name | 4-bromo-2-chloro-6-methoxybenzonitrile |
| InChIKey | CUZXFNWNRKLLKW-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)Br)Cl)C#N |
Computed by PubChem (NCBI)