cas: 808127-76-6 — see every product listed under this CAS number, including other names
4-Bromo-6-hydroxyisoindolin-1-one, 95% (CAS 808127-76-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A122483-5g |
| cas | 808127-76-6 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 14717.50 Pln | |
| Fluorochem | 1g | 9374.84 Pln | |
| Fluorochem | 5g | 27936.01 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-bromo-6-hydroxy-2,3-dihydroisoindol-1-one (CAS 808127-76-6) is a chemical compound with the molecular formula C8H6BrNO2 and a molecular weight of 228.04 g/mol. IUPAC name: 4-bromo-6-hydroxy-2,3-dihydroisoindol-1-one. InChIKey: BQPRSUFYMWPKEI-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO2 |
|---|---|
| Molecular weight | 228.04 g/mol |
| IUPAC name | 4-bromo-6-hydroxy-2,3-dihydroisoindol-1-one |
| InChIKey | BQPRSUFYMWPKEI-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C(C=C2Br)O)C(=O)N1 |
Computed by PubChem (NCBI)