4-Bromo-6-nitro-1H-indazole, 95%
cas: 885518-54-7 — see every product listed under this CAS number, including other names
4-Bromo-6-nitro-1H-indazole, 95% (CAS 885518-54-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g, 250mg, 2.5g, 10g, 25g, 100mg. Offered by: Combi-blocks, Fluorochem, Ambeed, BLDpharm.
| brand | Combi-blocks |
|---|---|
| catalog number | QB-0266-5g |
| cas | 885518-54-7 |
| size | 5g |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 250mg | price on request | |
| Fluorochem | 250mg | 174.96 Pln | |
| Fluorochem | 1g | 414.46 Pln | |
| Fluorochem | 2.5g | 935.11 Pln | |
| Fluorochem | 5g | 1153.78 Pln | |
| Fluorochem | 10g | 1835.83 Pln | |
| Fluorochem | 25g | 3866.36 Pln | |
| Ambeed | 100mg | 159.00 Pln | |
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 414.88 Pln | |
| Ambeed | 5g | 1121.31 Pln | |
| Ambeed | 25g | 3785.75 Pln | |
| BLDpharm | 100mg | 147.75 Pln | |
| BLDpharm | 250mg | 236.61 Pln | |
| BLDpharm | 1g | 442.09 Pln | |
| BLDpharm | 5g | 1202.93 Pln | |
| BLDpharm | 25g | 4074.15 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
4-bromo-6-nitro-1H-indazole (CAS 885518-54-7) is a chemical compound with the molecular formula C7H4BrN3O2 and a molecular weight of 242.03 g/mol. IUPAC name: 4-bromo-6-nitro-1H-indazole. InChIKey: MFKKWYOQLIACFO-UHFFFAOYSA-N.
| Molecular formula | C7H4BrN3O2 |
|---|---|
| Molecular weight | 242.03 g/mol |
| IUPAC name | 4-bromo-6-nitro-1H-indazole |
| InChIKey | MFKKWYOQLIACFO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1NN=C2)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)