CAS 52310-43-7 appears in our catalog under these names: 3-Bromo-8-nitroimidazo[1,2-a]pyridine, 95%, 3-Bromo-8-nitroimidazo(1,2-a)pyridine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg, 10g, 25g.
3-bromo-8-nitroimidazo[1,2-a]pyridine (CAS 52310-43-7) is a chemical compound with the molecular formula C7H4BrN3O2 and a molecular weight of 242.03 g/mol. IUPAC name: 3-bromo-8-nitroimidazo[1,2-a]pyridine. InChIKey: IXGSGWPFHHPIQZ-UHFFFAOYSA-N.
| Molecular formula | C7H4BrN3O2 |
|---|---|
| Molecular weight | 242.03 g/mol |
| IUPAC name | 3-bromo-8-nitroimidazo[1,2-a]pyridine |
| InChIKey | IXGSGWPFHHPIQZ-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=CN=C2C(=C1)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)