CAS 885518-54-7 is the registry number for 4-Bromo-6-nitro-1H-indazole, 95%. Offered by: Combi-blocks, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 250mg, 2.5g, 10g, 25g, 100mg.
4-bromo-6-nitro-1H-indazole (CAS 885518-54-7) is a chemical compound with the molecular formula C7H4BrN3O2 and a molecular weight of 242.03 g/mol. IUPAC name: 4-bromo-6-nitro-1H-indazole. InChIKey: MFKKWYOQLIACFO-UHFFFAOYSA-N.
| Molecular formula | C7H4BrN3O2 |
|---|---|
| Molecular weight | 242.03 g/mol |
| IUPAC name | 4-bromo-6-nitro-1H-indazole |
| InChIKey | MFKKWYOQLIACFO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1NN=C2)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)