Products 1214902-65-4
CAS 1214902-65-4 is the registry number for 2-Bromo-[1,2,4]triazolo[1,5-a]pyridine-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-bromo-[1,2,4]triazolo[1,5-a]pyridine-5-carboxylic acid (CAS 1214902-65-4) is a chemical compound with the molecular formula C7H4BrN3O2 and a molecular weight of 242.03 g/mol. IUPAC name: 2-bromo-[1,2,4]triazolo[1,5-a]pyridine-5-carboxylic acid. InChIKey: RYIYWYJKBZXUBW-UHFFFAOYSA-N.
| Molecular formula | C7H4BrN3O2 |
|---|---|
| Molecular weight | 242.03 g/mol |
| IUPAC name | 2-bromo-[1,2,4]triazolo[1,5-a]pyridine-5-carboxylic acid |
| InChIKey | RYIYWYJKBZXUBW-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=NN2C(=C1)C(=O)O)Br |
Computed by PubChem (NCBI)