CAS 1196154-13-8 appears in our catalog under these names: 6-Bromoimidazo[1,2-a]pyrazine-8-carboxylic acid, 95%, 6-Bromoimidazo[1,2-a]pyrazine-8-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.
6-bromoimidazo[1,2-a]pyrazine-8-carboxylic acid (CAS 1196154-13-8) is a chemical compound with the molecular formula C7H4BrN3O2 and a molecular weight of 242.03 g/mol. IUPAC name: 6-bromoimidazo[1,2-a]pyrazine-8-carboxylic acid. InChIKey: WAWFNUFLTNAHLV-UHFFFAOYSA-N.
| Molecular formula | C7H4BrN3O2 |
|---|---|
| Molecular weight | 242.03 g/mol |
| IUPAC name | 6-bromoimidazo[1,2-a]pyrazine-8-carboxylic acid |
| InChIKey | WAWFNUFLTNAHLV-UHFFFAOYSA-N |
| SMILES | C1=CN2C=C(N=C(C2=N1)C(=O)O)Br |
Computed by PubChem (NCBI)