cas: 6940-50-7 — see every product listed under this CAS number, including other names
4-Bromomandelicacid, 95%, 95% (CAS 6940-50-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g, 50g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114L16-250mg |
| cas | 6940-50-7 |
| size | 250mg |
| availability | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 93.20 Pln | |
| Chemat | 25g | 170.00 Pln | |
| Chemat | 100g | 448.40 Pln | |
| Chemat | 50g | 270.80 Pln | |
| Chemat | 250g | 1029.20 Pln | |
| Chemat | 500g | 2064.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-(4-bromophenyl)-2-hydroxyacetic acid (CAS 6940-50-7) is a chemical compound with the molecular formula C8H7BrO3 and a molecular weight of 231.04 g/mol. IUPAC name: 2-(4-bromophenyl)-2-hydroxyacetic acid. InChIKey: BHZBRPQOYFDTAB-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO3 |
|---|---|
| Molecular weight | 231.04 g/mol |
| IUPAC name | 2-(4-bromophenyl)-2-hydroxyacetic acid |
| InChIKey | BHZBRPQOYFDTAB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(=O)O)O)Br |
Computed by PubChem (NCBI)