Products 123484-90-2
CAS 123484-90-2 appears in our catalog under these names: (2S)-2-(4-Bromophenyl)-2-hydroxyacetic acid, (2S)-2-(4-Bromophenyl)-2-hydroxyacetic acid, 98%, (2S)-2-(4-Bromophenyl)-2-hydroxyacetic acid, 98%, 98%. Offered by: Biosynth, Fluorochem, Chemat. Available pack sizes: 50mg, 0,5g, 500mg, 1g, 100mg, 250mg.
(2S)-2-(4-bromophenyl)-2-hydroxyacetic acid (CAS 123484-90-2) is a chemical compound with the molecular formula C8H7BrO3 and a molecular weight of 231.04 g/mol. IUPAC name: (2S)-2-(4-bromophenyl)-2-hydroxyacetic acid. InChIKey: BHZBRPQOYFDTAB-ZETCQYMHSA-N.
| Molecular formula | C8H7BrO3 |
|---|---|
| Molecular weight | 231.04 g/mol |
| IUPAC name | (2S)-2-(4-bromophenyl)-2-hydroxyacetic acid |
| InChIKey | BHZBRPQOYFDTAB-ZETCQYMHSA-N |
| SMILES | C1=CC(=CC=C1[C@@H](C(=O)O)O)Br |
Computed by PubChem (NCBI)
Synonyms:
p-Bromomandelic acid, (+)-, L-4-bromomandelic acid, (S)-p-Bromomandelic acid, (+)-4-Bromomandelic acid, Benzeneacetic acid, 4-bromo-alpha-hydroxy-, (alphaS)-, (2S)-2-(4-bromophenyl)-2-hydroxyacetic acid, (S)-2-(4-Bromophenyl)-2-hydroxyacetic acid, (2S)-2-(4-bromophenyl)-2-hydroxyacetic acid >99%ee, Benzeneacetic acid, 4-bromo-a-hydroxy-, (aS)-, (2S)-2-(4-Bromophenyl)-2-hydroxyacetic acid>99%ee