Products 32189-34-7
CAS 32189-34-7 appears in our catalog under these names: (R)-4-Bromomandelic acid, (R)-2-(4-Bromophenyl)-2-hydroxyacetic acid, 95%. Offered by: Biosynth, Chemat. Available pack sizes: 0,5g, 50mg, 1g.
(2R)-2-(4-bromophenyl)-2-hydroxyacetic acid (CAS 32189-34-7) is a chemical compound with the molecular formula C8H7BrO3 and a molecular weight of 231.04 g/mol. IUPAC name: (2R)-2-(4-bromophenyl)-2-hydroxyacetic acid. InChIKey: BHZBRPQOYFDTAB-SSDOTTSWSA-N.
| Molecular formula | C8H7BrO3 |
|---|---|
| Molecular weight | 231.04 g/mol |
| IUPAC name | (2R)-2-(4-bromophenyl)-2-hydroxyacetic acid |
| InChIKey | BHZBRPQOYFDTAB-SSDOTTSWSA-N |
| SMILES | C1=CC(=CC=C1[C@H](C(=O)O)O)Br |
Computed by PubChem (NCBI)
Synonyms:
D-4-bromomandelic acid, p-Bromomandelic acid, (-)-, (-)-4-Bromomandelic acid, Benzeneacetic acid, 4-bromo-alpha-hydroxy-, (alphaR)-, (2R)-2-(4-bromophenyl)-2-hydroxyacetic acid, (R)-2-(4-Bromophenyl)-2-hydroxyacetic acid, (2R)-2-(4-bromophenyl)-2-hydroxyacetic acid >99%ee, (-)-p-bromomandelic acid, (2R)-(4-Bromophenyl)(hydroxy)acetic acid, (R)-2-(4-Bromophenyl)-2-hydroxyaceticacid