cas: 571-57-3 — see every product listed under this CAS number, including other names
4-Bromonaphthalen-1-ol, 98%, 98% (CAS 571-57-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11482Q-1g |
| cas | 571-57-3 |
| size | 1g |
| availability | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 83.60 Pln | |
| Chemat | 25g | 112.40 Pln | |
| Chemat | 50g | 160.40 Pln | |
| Chemat | 100g | 256.40 Pln | |
| Chemat | 250g | 438.80 Pln | |
| Chemat | 500g | 753.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-bromonaphthalen-1-ol (CAS 571-57-3) is a chemical compound with the molecular formula C10H7BrO and a molecular weight of 223.07 g/mol. IUPAC name: 4-bromonaphthalen-1-ol. InChIKey: OUNQUWORSXHSJN-UHFFFAOYSA-N.
| Molecular formula | C10H7BrO |
|---|---|
| Molecular weight | 223.07 g/mol |
| IUPAC name | 4-bromonaphthalen-1-ol |
| InChIKey | OUNQUWORSXHSJN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2Br)O |
Computed by PubChem (NCBI)