cas: 80352-42-7 — see every product listed under this CAS number, including other names
4-Bromophenyl glyoxal hydrate (CAS 80352-42-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F033142-250MG |
| cas | 80352-42-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 138.51 Pln | |
| Fluorochem | 1g | 372.80 Pln | |
| Fluorochem | 5g | 919.49 Pln |
| delivery time | 2-3 weeks |
|---|
2-(4-bromophenyl)-2-oxoacetaldehyde;hydrate (CAS 80352-42-7) is a chemical compound with the molecular formula C8H7BrO3 and a molecular weight of 231.04 g/mol. IUPAC name: 2-(4-bromophenyl)-2-oxoacetaldehyde;hydrate. InChIKey: IOONPDHKLYFDML-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO3 |
|---|---|
| Molecular weight | 231.04 g/mol |
| IUPAC name | 2-(4-bromophenyl)-2-oxoacetaldehyde;hydrate |
| InChIKey | IOONPDHKLYFDML-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C=O)Br.O |
Computed by PubChem (NCBI)