cas: 80352-42-7 — see every product listed under this CAS number, including other names
4-Bromophenylglyoxal hydrate, 96%+(LC-MS),RG, 96%+(LC-MS),RG (CAS 80352-42-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116BHP-1g |
| cas | 80352-42-7 |
| size | 1g |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 328.40 Pln | |
| Chemat | 5g | 573.20 Pln | |
| Chemat | 25g | 1566.80 Pln | |
| Chemat | 100g | 5771.60 Pln |
| purity | 96%+(LC-MS),RG |
|---|---|
| delivery time | 3 weeks |
2-(4-bromophenyl)-2-oxoacetaldehyde;hydrate (CAS 80352-42-7) is a chemical compound with the molecular formula C8H7BrO3 and a molecular weight of 231.04 g/mol. IUPAC name: 2-(4-bromophenyl)-2-oxoacetaldehyde;hydrate. InChIKey: IOONPDHKLYFDML-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO3 |
|---|---|
| Molecular weight | 231.04 g/mol |
| IUPAC name | 2-(4-bromophenyl)-2-oxoacetaldehyde;hydrate |
| InChIKey | IOONPDHKLYFDML-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C=O)Br.O |
Computed by PubChem (NCBI)