CAS 859775-25-0 appears in our catalog under these names: 2-(4-Bromophenyl)-2-oxoacetaldehyde hydrate 95%, Benzeneacetaldehyde, 4-bromo-α-oxo-, hydrate (1:1), 95%, 95%, 4-Bromophenylglyoxal hydrate, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 250mg, 1g, 5g, 25g, 10g.
2-(4-bromophenyl)-2-oxoacetaldehyde;hydrate (CAS 859775-25-0) is a chemical compound with the molecular formula C8H7BrO3 and a molecular weight of 231.04 g/mol. IUPAC name: 2-(4-bromophenyl)-2-oxoacetaldehyde;hydrate. InChIKey: IOONPDHKLYFDML-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO3 |
|---|---|
| Molecular weight | 231.04 g/mol |
| IUPAC name | 2-(4-bromophenyl)-2-oxoacetaldehyde;hydrate |
| InChIKey | IOONPDHKLYFDML-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C=O)Br.O |
Computed by PubChem (NCBI)