cas: 354574-59-7 — see every product listed under this CAS number, including other names
4-Bromoquinazoline 97% (CAS 354574-59-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A148856-100mg |
| cas | 354574-59-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 147.88 Pln | |
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 459.38 Pln | |
| Ambeed | 5g | 1933.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A148856 |
4-bromoquinazoline (CAS 354574-59-7) is a chemical compound with the molecular formula C8H5BrN2 and a molecular weight of 209.04 g/mol. IUPAC name: 4-bromoquinazoline. InChIKey: WJYKTNSYMVJDBR-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2 |
|---|---|
| Molecular weight | 209.04 g/mol |
| IUPAC name | 4-bromoquinazoline |
| InChIKey | WJYKTNSYMVJDBR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NC=N2)Br |
Computed by PubChem (NCBI)