cas: 156487-12-6 — see every product listed under this CAS number, including other names
4-Butoxy-2,3-difluorophenylboronic acid, 98%, 98% (CAS 156487-12-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112OR7-250mg |
| cas | 156487-12-6 |
| size | 250mg |
| availability | 225g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 160.40 Pln | |
| Chemat | 25g | 544.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(4-butoxy-2,3-difluorophenyl)boronic acid (CAS 156487-12-6) is a chemical compound with the molecular formula C10H13BF2O3 and a molecular weight of 230.02 g/mol. IUPAC name: (4-butoxy-2,3-difluorophenyl)boronic acid. InChIKey: NVIGFYPVKZNNAZ-UHFFFAOYSA-N.
| Molecular formula | C10H13BF2O3 |
|---|---|
| Molecular weight | 230.02 g/mol |
| IUPAC name | (4-butoxy-2,3-difluorophenyl)boronic acid |
| InChIKey | NVIGFYPVKZNNAZ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)OCCCC)F)F)(O)O |
Computed by PubChem (NCBI)