cas: 41490-11-3 — see every product listed under this CAS number, including other names
4-Butoxy-3,5-dichlorobenzoic acid, ≥95%, ≥95% (CAS 41490-11-3) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch128U9D-1g |
| cas | 41490-11-3 |
| size | 1g |
| availability | 17g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 2718.80 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
4-butoxy-3,5-dichlorobenzoic acid (CAS 41490-11-3) is a chemical compound with the molecular formula C11H12Cl2O3 and a molecular weight of 263.11 g/mol. IUPAC name: 4-butoxy-3,5-dichlorobenzoic acid. InChIKey: PYHMOPIRWGCPQM-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2O3 |
|---|---|
| Molecular weight | 263.11 g/mol |
| IUPAC name | 4-butoxy-3,5-dichlorobenzoic acid |
| InChIKey | PYHMOPIRWGCPQM-UHFFFAOYSA-N |
| SMILES | CCCCOC1=C(C=C(C=C1Cl)C(=O)O)Cl |
Computed by PubChem (NCBI)