Products 1698415-57-4
CAS 1698415-57-4 is the registry number for Ethyl 3-(2,5-dichlorophenyl)-3-hydroxypropanoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 3-(2,5-dichlorophenyl)-3-hydroxypropanoate (CAS 1698415-57-4) is a chemical compound with the molecular formula C11H12Cl2O3 and a molecular weight of 263.11 g/mol. IUPAC name: ethyl 3-(2,5-dichlorophenyl)-3-hydroxypropanoate. InChIKey: YNWWSXSENSPSDE-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2O3 |
|---|---|
| Molecular weight | 263.11 g/mol |
| IUPAC name | ethyl 3-(2,5-dichlorophenyl)-3-hydroxypropanoate |
| InChIKey | YNWWSXSENSPSDE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(C1=C(C=CC(=C1)Cl)Cl)O |
Computed by PubChem (NCBI)