CAS 856165-88-3 appears in our catalog under these names: Methyl 3,5-dichloro-4-isopropoxybenzoate, 95%, Methyl 3,5-dichloro-4-isopropoxybenzoate, 97%, Methyl 3,5-dichloro-4-isopropoxybenzoate. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
Methyl 3,5-dichloro-4-propan-2-yloxybenzoate (CAS 856165-88-3) is a chemical compound with the molecular formula C11H12Cl2O3 and a molecular weight of 263.11 g/mol. IUPAC name: methyl 3,5-dichloro-4-propan-2-yloxybenzoate. InChIKey: BZGWUEFCUVETLA-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2O3 |
|---|---|
| Molecular weight | 263.11 g/mol |
| IUPAC name | methyl 3,5-dichloro-4-propan-2-yloxybenzoate |
| InChIKey | BZGWUEFCUVETLA-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=C(C=C1Cl)C(=O)OC)Cl |
Computed by PubChem (NCBI)