CAS 938132-25-3 appears in our catalog under these names: 3-(3,5-Dichlorophenoxy)-2,2-dimethylpropanoic acid, 3-(3,5-Dichlorophenoxy)-2,2-dimethylpropanoic acid, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 0,5g, 50mg, 5g, 1g, 250mg.
3-(3,5-dichlorophenoxy)-2,2-dimethylpropanoic acid (CAS 938132-25-3) is a chemical compound with the molecular formula C11H12Cl2O3 and a molecular weight of 263.11 g/mol. IUPAC name: 3-(3,5-dichlorophenoxy)-2,2-dimethylpropanoic acid. InChIKey: WNHMFSDYTVEJNO-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2O3 |
|---|---|
| Molecular weight | 263.11 g/mol |
| IUPAC name | 3-(3,5-dichlorophenoxy)-2,2-dimethylpropanoic acid |
| InChIKey | WNHMFSDYTVEJNO-UHFFFAOYSA-N |
| SMILES | CC(C)(COC1=CC(=CC(=C1)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)