Products 61961-06-6

CAS 61961-06-6 is the registry number for 2,4-DB Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Propan-2-yl 2-(2,6-dichlorophenoxy)acetate (CAS 61961-06-6) is a chemical compound with the molecular formula C11H12Cl2O3 and a molecular weight of 263.11 g/mol. IUPAC name: propan-2-yl 2-(2,6-dichlorophenoxy)acetate. InChIKey: RBIPTZCFDFLKIZ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12Cl2O3
Molecular weight263.11 g/mol
IUPAC namepropan-2-yl 2-(2,6-dichlorophenoxy)acetate
InChIKeyRBIPTZCFDFLKIZ-UHFFFAOYSA-N
SMILESCC(C)OC(=O)COC1=C(C=CC=C1Cl)Cl

Computed by PubChem (NCBI)

Synonyms: 2,4-DB Impurity 1