Products 40689-34-7

CAS 40689-34-7 is the registry number for Ethyl 3,5-dichloro-4-ethoxybenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

Ethyl 3,5-dichloro-4-ethoxybenzoate (CAS 40689-34-7) is a chemical compound with the molecular formula C11H12Cl2O3 and a molecular weight of 263.11 g/mol. IUPAC name: ethyl 3,5-dichloro-4-ethoxybenzoate. InChIKey: SYAONARMDDWWPI-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12Cl2O3
Molecular weight263.11 g/mol
IUPAC nameethyl 3,5-dichloro-4-ethoxybenzoate
InChIKeySYAONARMDDWWPI-UHFFFAOYSA-N
SMILESCCOC1=C(C=C(C=C1Cl)C(=O)OCC)Cl

Computed by PubChem (NCBI)