Products 172032-21-2
CAS 172032-21-2 appears in our catalog under these names: Itraconazole Impurity 30, Itraconazole Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.
[2-(2,4-dichlorophenyl)-2-methyl-1,3-dioxolan-4-yl]methanol (CAS 172032-21-2) is a chemical compound with the molecular formula C11H12Cl2O3 and a molecular weight of 263.11 g/mol. IUPAC name: [2-(2,4-dichlorophenyl)-2-methyl-1,3-dioxolan-4-yl]methanol. InChIKey: NFZUBQHKYXWWNI-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2O3 |
|---|---|
| Molecular weight | 263.11 g/mol |
| IUPAC name | [2-(2,4-dichlorophenyl)-2-methyl-1,3-dioxolan-4-yl]methanol |
| InChIKey | NFZUBQHKYXWWNI-UHFFFAOYSA-N |
| SMILES | CC1(OCC(O1)CO)C2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)