CAS 86825-96-9 appears in our catalog under these names: 4-Chlorothieno[2,3-d]pyrimidine-6-carboxylic acid, 95%, 4-Chlorothieno(2,3-d)pyrimidine-6-carboxylic acid, 98%, 4-Chlorothieno(2,3-d)pyrimidine-6-carboxylic acid, 4-CHLOROTHIENO[2,3-D]PYRIMIDINE-6-CARBOXYLIC ACID, ≥97%. Offered by: Combi-blocks, AmBeed, Biosynth, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 10g, 5g.
4-chlorothieno[2,3-d]pyrimidine-6-carboxylic acid (CAS 86825-96-9) is a chemical compound with the molecular formula C7H3ClN2O2S and a molecular weight of 214.63 g/mol. IUPAC name: 4-chlorothieno[2,3-d]pyrimidine-6-carboxylic acid. InChIKey: ZWZIELMLHCTSQY-UHFFFAOYSA-N.
| Molecular formula | C7H3ClN2O2S |
|---|---|
| Molecular weight | 214.63 g/mol |
| IUPAC name | 4-chlorothieno[2,3-d]pyrimidine-6-carboxylic acid |
| InChIKey | ZWZIELMLHCTSQY-UHFFFAOYSA-N |
| SMILES | C1=C(SC2=C1C(=NC=N2)Cl)C(=O)O |
Computed by PubChem (NCBI)