CAS 3622-38-6 appears in our catalog under these names: 2-Chloro-5-nitrobenzo[d]thiazole 97%, 2-Chloro-5-nitrobenzo[d]thiazole, 95%, 95%, 2-Chloro-5-nitro-1,3-benzothiazole, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g.
2-chloro-5-nitro-1,3-benzothiazole (CAS 3622-38-6) is a chemical compound with the molecular formula C7H3ClN2O2S and a molecular weight of 214.63 g/mol. IUPAC name: 2-chloro-5-nitro-1,3-benzothiazole. InChIKey: BSHJRTMGKFPQGZ-UHFFFAOYSA-N.
| Molecular formula | C7H3ClN2O2S |
|---|---|
| Molecular weight | 214.63 g/mol |
| IUPAC name | 2-chloro-5-nitro-1,3-benzothiazole |
| InChIKey | BSHJRTMGKFPQGZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])N=C(S2)Cl |
Computed by PubChem (NCBI)