cas: 1247927-81-6 — see every product listed under this CAS number, including other names
4-CYCLOPROPYL-2-FLUOROBENZOIC ACID, 98% (CAS 1247927-81-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F536079-100MG |
| cas | 1247927-81-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 529.00 Pln | |
| Fluorochem | 250mg | 815.36 Pln | |
| Fluorochem | 500mg | 1424.52 Pln | |
| Fluorochem | 1g | 1851.45 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-cyclopropyl-2-fluorobenzoic acid (CAS 1247927-81-6) is a chemical compound with the molecular formula C10H9FO2 and a molecular weight of 180.17 g/mol. IUPAC name: 4-cyclopropyl-2-fluorobenzoic acid. InChIKey: UPYZCTDSUYXKBG-UHFFFAOYSA-N.
| Molecular formula | C10H9FO2 |
|---|---|
| Molecular weight | 180.17 g/mol |
| IUPAC name | 4-cyclopropyl-2-fluorobenzoic acid |
| InChIKey | UPYZCTDSUYXKBG-UHFFFAOYSA-N |
| SMILES | C1CC1C2=CC(=C(C=C2)C(=O)O)F |
Computed by PubChem (NCBI)