Products 774-20-9
CAS 774-20-9 is the registry number for 7-Fluoro-3,4-dihydro-1-benzoxepin-5(2h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
7-fluoro-3,4-dihydro-2H-1-benzoxepin-5-one (CAS 774-20-9) is a chemical compound with the molecular formula C10H9FO2 and a molecular weight of 180.17 g/mol. IUPAC name: 7-fluoro-3,4-dihydro-2H-1-benzoxepin-5-one. InChIKey: CIPGQCNTJQBNLR-UHFFFAOYSA-N.
| Molecular formula | C10H9FO2 |
|---|---|
| Molecular weight | 180.17 g/mol |
| IUPAC name | 7-fluoro-3,4-dihydro-2H-1-benzoxepin-5-one |
| InChIKey | CIPGQCNTJQBNLR-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C(C=CC(=C2)F)OC1 |
Computed by PubChem (NCBI)