CAS 295779-82-7 appears in our catalog under these names: 6-Fluoro-5-methoxy-2,3-dihydro-1h-inden-1-one, 95%, 6-Fluoro-5-methoxy-2,3-dihydro-1H-inden-1-one, 6-Fluoro-5-methoxy-2,3-dihydro-1H-inden-1-one 95%, 6-Fluoro-5-methoxy-2,3-dihydro-1H-inden-1-one, 95%, 95%, 6-Fluoro-5-methoxy-2,3-dihydro-1H-inden-1-one, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 2,5g.
6-fluoro-5-methoxy-2,3-dihydroinden-1-one (CAS 295779-82-7) is a chemical compound with the molecular formula C10H9FO2 and a molecular weight of 180.17 g/mol. IUPAC name: 6-fluoro-5-methoxy-2,3-dihydroinden-1-one. InChIKey: UEAXBANALITWAP-UHFFFAOYSA-N.
| Molecular formula | C10H9FO2 |
|---|---|
| Molecular weight | 180.17 g/mol |
| IUPAC name | 6-fluoro-5-methoxy-2,3-dihydroinden-1-one |
| InChIKey | UEAXBANALITWAP-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)CCC2=O)F |
Computed by PubChem (NCBI)